C57H50Br2N2OP2 — CID 91061816
bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-dimethylphenyl]methyl]-triphenyl-λ5-phosphane;6-pyridin-2-ylpyridine-3-carbaldehyde (PubChem CID 91061816) has the molecular formula C57H50Br2N2OP2 and a molecular weight of 1000.80 g/mol. Its IUPAC name is bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-dimethylphenyl]methyl]-triphenyl-λ5-phosphane;6-pyridin-2-ylpyridine-3-carbaldehyde.
| Compound Name | bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-dimethylphenyl]methyl]-triphenyl-λ5-phosphane;6-pyridin-2-ylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 91061816 |
| Molecular Formula | C57H50Br2N2OP2 |
| Molecular Weight | 1000.80 g/mol |
| Exact Mass | 998.18 |
| IUPAC Name | bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-dimethylphenyl]methyl]-triphenyl-λ5-phosphane;6-pyridin-2-ylpyridine-3-carbaldehyde |
| SMILES | Cc1cc(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c(C)cc1CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.O=Cc1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C46H42Br2P2.C11H8N2O/c1-37-33-40(36-50(48,44-27-15-6-16-28-44,45-29-17-7-18-30-45)46-31-19-8-20-32-46)38(2)34-39(37)35-49(47,41-21-9-3-10-22-41,42-23-11-4-12-24-42)43-25-13-5-14-26-43;14-8-9-4-5-11(13-7-9)10-3-1-2-6-12-10/h3-34H,35-36H2,1-2H3;1-8H |
| InChIKey | WZSCLBPBABZYIT-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.80 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|