C7H14N3O3PS — CID 91061905
methanesulfonic acid;4-methylimino-1-phosphanylpyrrolidine-3-carbonitrile (PubChem CID 91061905) has the molecular formula C7H14N3O3PS and a molecular weight of 251.25 g/mol. Its IUPAC name is methanesulfonic acid;4-methylimino-1-phosphanylpyrrolidine-3-carbonitrile.
| Compound Name | methanesulfonic acid;4-methylimino-1-phosphanylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 91061905 |
| Molecular Formula | C7H14N3O3PS |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | methanesulfonic acid;4-methylimino-1-phosphanylpyrrolidine-3-carbonitrile |
| SMILES | C/N=C1\CN(P)CC1C#N.CS(=O)(=O)O |
| InChI | InChI=1S/C6H10N3P.CH4O3S/c1-8-6-4-9(10)3-5(6)2-7;1-5(2,3)4/h5H,3-4,10H2,1H3;1H3,(H,2,3,4)/b8-6+; |
| InChIKey | GUHUBOVKTCHVOK-WVLIHFOGSA-N |
| XLogP | -0.19 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|