C23H18F2N4O2S — CID 91064432
1-[(6-amino-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)phenyl]imino-4-phenyl-5-sulfanylidenepyrrolidin-2-one (PubChem CID 91064432) has the molecular formula C23H18F2N4O2S and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-[(6-amino-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)phenyl]imino-4-phenyl-5-sulfanylidenepyrrolidin-2-one.
| Compound Name | 1-[(6-amino-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)phenyl]imino-4-phenyl-5-sulfanylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 91064432 |
| Molecular Formula | C23H18F2N4O2S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[(6-amino-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)phenyl]imino-4-phenyl-5-sulfanylidenepyrrolidin-2-one |
| SMILES | Nc1ccc(CN2C(=O)/C(=N\c3ccc(OC(F)F)cc3)C(c3ccccc3)C2=S)cn1 |
| InChI | InChI=1S/C23H18F2N4O2S/c24-23(25)31-17-9-7-16(8-10-17)28-20-19(15-4-2-1-3-5-15)22(32)29(21(20)30)13-14-6-11-18(26)27-12-14/h1-12,19,23H,13H2,(H2,26,27)/b28-20- |
| InChIKey | OVXLWZORAOWUBY-RRAHZORUSA-N |
| XLogP | 4.49 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|