C20H20N2O3S — CID 91558880
1-(2-methoxyethyl)-4-(4-methoxyphenyl)imino-3-phenyl-5-sulfanylidenepyrrolidin-2-one (PubChem CID 91558880) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-(4-methoxyphenyl)imino-3-phenyl-5-sulfanylidenepyrrolidin-2-one.
| Compound Name | 1-(2-methoxyethyl)-4-(4-methoxyphenyl)imino-3-phenyl-5-sulfanylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 91558880 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-(2-methoxyethyl)-4-(4-methoxyphenyl)imino-3-phenyl-5-sulfanylidenepyrrolidin-2-one |
| SMILES | COCCN1C(=O)C(c2ccccc2)/C(=N/c2ccc(OC)cc2)C1=S |
| InChI | InChI=1S/C20H20N2O3S/c1-24-13-12-22-19(23)17(14-6-4-3-5-7-14)18(20(22)26)21-15-8-10-16(25-2)11-9-15/h3-11,17H,12-13H2,1-2H3/b21-18- |
| InChIKey | CVCZBMKTXWJWAS-UZYVYHOESA-N |
| XLogP | 3.37 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|