C23H20N4O3 — CID 91284009
1-[(6-amino-3-pyridinyl)methyl]-3-(4-methoxyphenyl)imino-4-phenylpyrrolidine-2,5-dione (PubChem CID 91284009) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-[(6-amino-3-pyridinyl)methyl]-3-(4-methoxyphenyl)imino-4-phenylpyrrolidine-2,5-dione.
| Compound Name | 1-[(6-amino-3-pyridinyl)methyl]-3-(4-methoxyphenyl)imino-4-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 91284009 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[(6-amino-3-pyridinyl)methyl]-3-(4-methoxyphenyl)imino-4-phenylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(/N=C2\C(=O)N(Cc3ccc(N)nc3)C(=O)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N4O3/c1-30-18-10-8-17(9-11-18)26-21-20(16-5-3-2-4-6-16)22(28)27(23(21)29)14-15-7-12-19(24)25-13-15/h2-13,20H,14H2,1H3,(H2,24,25)/b26-21- |
| InChIKey | YUAIMABSLOGZKN-QLYXXIJNSA-N |
| XLogP | 3.10 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|