C20H10F21NO — CID 91064460
5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 91064460) has the molecular formula C20H10F21NO and a molecular weight of 679.26 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91064460 |
| Molecular Formula | C20H10F21NO |
| Molecular Weight | 679.26 g/mol |
| Exact Mass | 679.04 |
| IUPAC Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C20H10F21NO/c21-11(22,7-9-6-10(42-43-9)8-4-2-1-3-5-8)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)18(35,36)19(37,38)20(39,40)41/h1-6,9,42H,7H2 |
| InChIKey | QMNBFVZEFNTWOV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.26 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|