C12H11N5O4S2 — CID 91074111
carbamoyl 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-5-sulfonate (PubChem CID 91074111) has the molecular formula C12H11N5O4S2 and a molecular weight of 353.39 g/mol. Its IUPAC name is carbamoyl 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-5-sulfonate.
| Compound Name | carbamoyl 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-5-sulfonate |
|---|---|
| PubChem CID | 91074111 |
| Molecular Formula | C12H11N5O4S2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | carbamoyl 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-5-sulfonate |
| SMILES | Cc1[nH]nc(N)c1-c1nc2cc(S(=O)(=O)OC(N)=O)ccc2s1 |
| InChI | InChI=1S/C12H11N5O4S2/c1-5-9(10(13)17-16-5)11-15-7-4-6(2-3-8(7)22-11)23(19,20)21-12(14)18/h2-4H,1H3,(H2,14,18)(H3,13,16,17) |
| InChIKey | OJDKORSASWINPO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|