C13H13F3N5O3S2- — CID 162101523
2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-6-sulfonic acid;2,2,2-trifluoroethylazanide (PubChem CID 162101523) has the molecular formula C13H13F3N5O3S2- and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-6-sulfonic acid;2,2,2-trifluoroethylazanide.
| Compound Name | 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-6-sulfonic acid;2,2,2-trifluoroethylazanide |
|---|---|
| PubChem CID | 162101523 |
| Molecular Formula | C13H13F3N5O3S2- |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazole-6-sulfonic acid;2,2,2-trifluoroethylazanide |
| SMILES | Cc1[nH]nc(N)c1-c1nc2ccc(S(=O)(=O)O)cc2s1.[NH-]CC(F)(F)F |
| InChI | InChI=1S/C11H10N4O3S2.C2H3F3N/c1-5-9(10(12)15-14-5)11-13-7-3-2-6(20(16,17)18)4-8(7)19-11;3-2(4,5)1-6/h2-4H,1H3,(H3,12,14,15)(H,16,17,18);6H,1H2/q;-1 |
| InChIKey | ZEYIVVJQEKRGKA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|