C18H21ClN4O3S2 — CID 91075550
[[2-[(4-chlorophenyl)sulfonylamino]-3-phenylpropanoyl]-ethylamino]thiourea (PubChem CID 91075550) has the molecular formula C18H21ClN4O3S2 and a molecular weight of 440.98 g/mol. Its IUPAC name is [[2-[(4-chlorophenyl)sulfonylamino]-3-phenylpropanoyl]-ethylamino]thiourea.
| Compound Name | [[2-[(4-chlorophenyl)sulfonylamino]-3-phenylpropanoyl]-ethylamino]thiourea |
|---|---|
| PubChem CID | 91075550 |
| Molecular Formula | C18H21ClN4O3S2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [[2-[(4-chlorophenyl)sulfonylamino]-3-phenylpropanoyl]-ethylamino]thiourea |
| SMILES | CCN(NC(N)=S)C(=O)C(Cc1ccccc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN4O3S2/c1-2-23(21-18(20)27)17(24)16(12-13-6-4-3-5-7-13)22-28(25,26)15-10-8-14(19)9-11-15/h3-11,16,22H,2,12H2,1H3,(H3,20,21,27) |
| InChIKey | UQISXPSHDDLPQX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|