C21H24O6 — CID 91076087
(13R)-13,21-dihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),8,15,18,20-pentaene-2,11-dione (PubChem CID 91076087) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (13R)-13,21-dihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),8,15,18,20-pentaene-2,11-dione.
| Compound Name | (13R)-13,21-dihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),8,15,18,20-pentaene-2,11-dione |
|---|---|
| PubChem CID | 91076087 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (13R)-13,21-dihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),8,15,18,20-pentaene-2,11-dione |
| SMILES | COc1cc(O)c2c(c1)C=CC[C@@H](O)CC(=O)CC=C1CCCC1OC2=O |
| InChI | InChI=1S/C21H24O6/c1-26-17-10-14-5-2-6-15(22)11-16(23)9-8-13-4-3-7-19(13)27-21(25)20(14)18(24)12-17/h2,5,8,10,12,15,19,22,24H,3-4,6-7,9,11H2,1H3/t15-,19?/m1/s1 |
| InChIKey | RLDUBYOCAMLGET-NYRJJRHWSA-N |
| XLogP | 3.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|