C18H22O5 — CID 58750245
(6E,9S,12E)-9,18-dihydroxy-16-methoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one (PubChem CID 58750245) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (6E,9S,12E)-9,18-dihydroxy-16-methoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one.
| Compound Name | (6E,9S,12E)-9,18-dihydroxy-16-methoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58750245 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (6E,9S,12E)-9,18-dihydroxy-16-methoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one |
| SMILES | COc1cc(O)c2c(c1)/C=C/CC[C@H](O)C/C=C/CCOC2=O |
| InChI | InChI=1S/C18H22O5/c1-22-15-11-13-7-4-5-9-14(19)8-3-2-6-10-23-18(21)17(13)16(20)12-15/h2-4,7,11-12,14,19-20H,5-6,8-10H2,1H3/b3-2+,7-4+/t14-/m1/s1 |
| InChIKey | ZJGXKJUBECIFBR-WARHEGFQSA-N |
| XLogP | 3.06 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|