About 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole
5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole (PubChem CID 91078612) has the molecular formula C9H5N3O2S
and a molecular weight of 219.23 g/mol. Its IUPAC name is 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole.
Analyze 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole?
The IUPAC name of 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole (CID 91078612) is 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole.
What is the SMILES notation for 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole?
The canonical SMILES for 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole is c1coc(-c2ocnc2-c2nccs2)n1.
What is the InChIKey of 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole?
The InChIKey is JUCZPJLWZQOFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O2S/c1-3-13-8(10-1)7-6(12-5-14-7)9-11-2-4-15-9/h1-5H.
What are the key properties of 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole?
5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole has a molecular weight of 219.23 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-oxazol-2-yl)-4-(1,3-thiazol-2-yl)-1,3-oxazole is sourced from PubChem (CID 91078612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).