C26H31F3N8O — CID 91078661
6-methyl-N-[3-(2-methylmorpholin-4-yl)propyl]-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methyldiazenyl]pyrimidin-4-amine (PubChem CID 91078661) has the molecular formula C26H31F3N8O and a molecular weight of 528.58 g/mol. Its IUPAC name is 6-methyl-N-[3-(2-methylmorpholin-4-yl)propyl]-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methyldiazenyl]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[3-(2-methylmorpholin-4-yl)propyl]-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methyldiazenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91078661 |
| Molecular Formula | C26H31F3N8O |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 6-methyl-N-[3-(2-methylmorpholin-4-yl)propyl]-2-[[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]methyldiazenyl]pyrimidin-4-amine |
| SMILES | Cc1cc(NCCCN2CCOC(C)C2)nc(/N=N/Cc2ccc(Nc3cccc(C(F)(F)F)c3)cn2)n1 |
| InChI | InChI=1S/C26H31F3N8O/c1-18-13-24(30-9-4-10-37-11-12-38-19(2)17-37)35-25(33-18)36-32-16-22-7-8-23(15-31-22)34-21-6-3-5-20(14-21)26(27,28)29/h3,5-8,13-15,19,34H,4,9-12,16-17H2,1-2H3,(H,30,33,35)/b36-32+ |
| InChIKey | MTHVVTVIBVDHQZ-WIKZRCHHSA-N |
| XLogP | 5.75 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|