C27H26N4O6 — CID 91079490
2-[2-[carbamimidoyl(phenyl)carbamoyl]-4-ethylphenyl]-5-[carboxy(ethyl)carbamoyl]benzoic acid (PubChem CID 91079490) has the molecular formula C27H26N4O6 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[2-[carbamimidoyl(phenyl)carbamoyl]-4-ethylphenyl]-5-[carboxy(ethyl)carbamoyl]benzoic acid.
| Compound Name | 2-[2-[carbamimidoyl(phenyl)carbamoyl]-4-ethylphenyl]-5-[carboxy(ethyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 91079490 |
| Molecular Formula | C27H26N4O6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-[2-[carbamimidoyl(phenyl)carbamoyl]-4-ethylphenyl]-5-[carboxy(ethyl)carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)N(C(=O)c1cc(CC)ccc1-c1ccc(C(=O)N(CC)C(=O)O)cc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O6/c1-3-16-10-12-19(21(14-16)24(33)31(26(28)29)18-8-6-5-7-9-18)20-13-11-17(15-22(20)25(34)35)23(32)30(4-2)27(36)37/h5-15H,3-4H2,1-2H3,(H3,28,29)(H,34,35)(H,36,37) |
| InChIKey | ALCWMIVQZCDVTK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 165.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|