C14H17F9N4O3 — CID 91079542
1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,7,10-tetrazacyclododec-2-yl]-2,2,2-trifluoroethanone (PubChem CID 91079542) has the molecular formula C14H17F9N4O3 and a molecular weight of 460.30 g/mol. Its IUPAC name is 1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,7,10-tetrazacyclododec-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,7,10-tetrazacyclododec-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 91079542 |
| Molecular Formula | C14H17F9N4O3 |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,7,10-tetrazacyclododec-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCNCCNCCNCC1(C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H17F9N4O3/c15-12(16,17)8(28)11(9(29)13(18,19)20)7-26-4-3-24-1-2-25-5-6-27(11)10(30)14(21,22)23/h24-26H,1-7H2 |
| InChIKey | SXHHFMPJRJXMRT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|