C16H21F9N4O3 — CID 137424723
1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-2-yl]-2,2,2-trifluoroethanone (PubChem CID 137424723) has the molecular formula C16H21F9N4O3 and a molecular weight of 488.35 g/mol. Its IUPAC name is 1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 137424723 |
| Molecular Formula | C16H21F9N4O3 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 1-[1,2-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCCNCCNCCCNCC1(C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H21F9N4O3/c17-14(18,19)10(30)13(11(31)15(20,21)22)9-28-4-1-3-26-6-7-27-5-2-8-29(13)12(32)16(23,24)25/h26-28H,1-9H2 |
| InChIKey | WBROEBQKWOTQLA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|