C25H41NO2 — CID 91080690
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(5R)-5-methylnona-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 91080690) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(5R)-5-methylnona-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(5R)-5-methylnona-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 91080690 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(5R)-5-methylnona-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CCCC[C@@H](C)C=CC=C[C@@H]1[C@H]2CC(CCCCC(=O)N(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H41NO2/c1-5-6-11-19(2)12-7-9-14-22-23-17-20(16-21(23)18-24(22)27)13-8-10-15-25(28)26(3)4/h7,9,12,14,16,19,21-24,27H,5-6,8,10-11,13,15,17-18H2,1-4H3/t19-,21+,22-,23+,24-/m1/s1 |
| InChIKey | ZVWLRIKPEASVEJ-MENZVKOBSA-N |
| XLogP | 5.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|