C26H35NO2 — CID 91390705
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)buta-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 91390705) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)buta-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)buta-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 91390705 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)buta-1,3-dienyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | Cc1cccc(C=CC=C[C@@H]2[C@H]3CC(CCCCC(=O)N(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C26H35NO2/c1-19-9-8-12-20(15-19)10-4-6-13-23-24-17-21(16-22(24)18-25(23)28)11-5-7-14-26(29)27(2)3/h4,6,8-10,12-13,15-16,22-25,28H,5,7,11,14,17-18H2,1-3H3/t22-,23+,24-,25+/m0/s1 |
| InChIKey | APCJMBFSWQQKCZ-FQUZAXHOSA-N |
| XLogP | 5.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|