C26H37NO3 — CID 91237420
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-3-methyl-4-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 91237420) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-3-methyl-4-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-3-methyl-4-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 91237420 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-3-methyl-4-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CN(C)C(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](C=C[C@](C)(O)Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C26H37NO3/c1-26(30,18-19-9-5-4-6-10-19)14-13-22-23-16-20(15-21(23)17-24(22)28)11-7-8-12-25(29)27(2)3/h4-6,9-10,13-15,21-24,28,30H,7-8,11-12,16-18H2,1-3H3/t21-,22+,23-,24+,26-/m0/s1 |
| InChIKey | DFCCFWSYYJDEGL-YBTKJZEMSA-N |
| XLogP | 4.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|