C25H33NO2 — CID 90807214
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-(4-phenylbuta-1,3-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 90807214) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-(4-phenylbuta-1,3-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-(4-phenylbuta-1,3-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 90807214 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-(4-phenylbuta-1,3-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CN(C)C(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](C=CC=Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C25H33NO2/c1-26(2)25(28)15-9-7-13-20-16-21-18-24(27)22(23(21)17-20)14-8-6-12-19-10-4-3-5-11-19/h3-6,8,10-12,14,16,21-24,27H,7,9,13,15,17-18H2,1-2H3/t21-,22+,23-,24+/m0/s1 |
| InChIKey | RTRFHRVVHMVAOM-UARRHKHWSA-N |
| XLogP | 4.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|