C18H10Cl2F6N6O — CID 91084816
2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine (PubChem CID 91084816) has the molecular formula C18H10Cl2F6N6O and a molecular weight of 511.21 g/mol. Its IUPAC name is 2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91084816 |
| Molecular Formula | C18H10Cl2F6N6O |
| Molecular Weight | 511.21 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)Oc1ccc(C/N=N/c2cc(Nc3cc(C(F)(F)F)cc(Cl)n3)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C18H10Cl2F6N6O/c19-12-5-10(17(21,22)23)6-13(28-12)29-14-7-15(31-16(20)30-14)32-27-8-9-1-3-11(4-2-9)33-18(24,25)26/h1-7H,8H2,(H,28,29,30,31)/b32-27+ |
| InChIKey | DELYVIKVUNYLDO-QVAGMWBUSA-N |
| XLogP | 7.12 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.21 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|