C30H27N2OPS — CID 91086149
N-[3-methyl-4-(1,3-thiazol-5-yl)phenyl]acetamide;triphenylphosphane (PubChem CID 91086149) has the molecular formula C30H27N2OPS and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[3-methyl-4-(1,3-thiazol-5-yl)phenyl]acetamide;triphenylphosphane.
| Compound Name | N-[3-methyl-4-(1,3-thiazol-5-yl)phenyl]acetamide;triphenylphosphane |
|---|---|
| PubChem CID | 91086149 |
| Molecular Formula | C30H27N2OPS |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-[3-methyl-4-(1,3-thiazol-5-yl)phenyl]acetamide;triphenylphosphane |
| SMILES | CC(=O)Nc1ccc(-c2cncs2)c(C)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H12N2OS/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8-5-10(14-9(2)15)3-4-11(8)12-6-13-7-16-12/h1-15H;3-7H,1-2H3,(H,14,15) |
| InChIKey | LVCKXOSEKJPHBC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|