C36H43N5O5 — CID 91086172
N-[2-(methoxymethyl)-4-[[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]-1H-indole-3-carboxamide (PubChem CID 91086172) has the molecular formula C36H43N5O5 and a molecular weight of 625.77 g/mol. Its IUPAC name is N-[2-(methoxymethyl)-4-[[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]-1H-indole-3-carboxamide.
| Compound Name | N-[2-(methoxymethyl)-4-[[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 91086172 |
| Molecular Formula | C36H43N5O5 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | N-[2-(methoxymethyl)-4-[[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]carbamoyl]phenyl]-1H-indole-3-carboxamide |
| SMILES | COCc1cc(C(=O)Nc2ccc(C)cc2OCCCCCC(=O)N2CCN(C)CC2)ccc1NC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C36H43N5O5/c1-25-12-14-32(33(21-25)46-20-8-4-5-11-34(42)41-18-16-40(2)17-19-41)39-35(43)26-13-15-30(27(22-26)24-45-3)38-36(44)29-23-37-31-10-7-6-9-28(29)31/h6-7,9-10,12-15,21-23,37H,4-5,8,11,16-20,24H2,1-3H3,(H,38,44)(H,39,43) |
| InChIKey | KUKHLNLWSCUYMF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|