C29H42ClN3O5 — CID 70070732
N-[2-[6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-6-oxohexoxy]-4-methylphenyl]-2-methylbenzamide;hydrochloride (PubChem CID 70070732) has the molecular formula C29H42ClN3O5 and a molecular weight of 548.12 g/mol. Its IUPAC name is N-[2-[6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-6-oxohexoxy]-4-methylphenyl]-2-methylbenzamide;hydrochloride.
| Compound Name | N-[2-[6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-6-oxohexoxy]-4-methylphenyl]-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 70070732 |
| Molecular Formula | C29H42ClN3O5 |
| Molecular Weight | 548.12 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | N-[2-[6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-6-oxohexoxy]-4-methylphenyl]-2-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)c2ccccc2C)c(OCCCCCC(=O)N2CCN(CCOCCO)CC2)c1.Cl |
| InChI | InChI=1S/C29H41N3O5.ClH/c1-23-11-12-26(30-29(35)25-9-6-5-8-24(25)2)27(22-23)37-19-7-3-4-10-28(34)32-15-13-31(14-16-32)17-20-36-21-18-33;/h5-6,8-9,11-12,22,33H,3-4,7,10,13-21H2,1-2H3,(H,30,35);1H |
| InChIKey | PVEBEDFSTSAEJP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|