C15H19N4O2+ — CID 9108750
N'-methyl-N-(3-nitropyridin-1-ium-2-yl)-N'-phenylpropane-1,3-diamine (PubChem CID 9108750) has the molecular formula C15H19N4O2+ and a molecular weight of 287.34 g/mol. Its IUPAC name is N'-methyl-N-(3-nitropyridin-1-ium-2-yl)-N'-phenylpropane-1,3-diamine.
| Compound Name | N'-methyl-N-(3-nitropyridin-1-ium-2-yl)-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 9108750 |
| Molecular Formula | C15H19N4O2+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N'-methyl-N-(3-nitropyridin-1-ium-2-yl)-N'-phenylpropane-1,3-diamine |
| SMILES | CN(CCCNc1[nH+]cccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H18N4O2/c1-18(13-7-3-2-4-8-13)12-6-11-17-15-14(19(20)21)9-5-10-16-15/h2-5,7-10H,6,11-12H2,1H3,(H,16,17)/p+1 |
| InChIKey | UERQGIMXEXBEOB-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|