C14H13N4O2S+ — CID 9023742
N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-nitropyridin-1-ium-2-amine (PubChem CID 9023742) has the molecular formula C14H13N4O2S+ and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9023742 |
| Molecular Formula | C14H13N4O2S+ |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc[nH+]c1NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H12N4O2S/c19-18(20)11-5-3-8-15-14(11)16-9-7-13-17-10-4-1-2-6-12(10)21-13/h1-6,8H,7,9H2,(H,15,16)/p+1 |
| InChIKey | FBIAJWYFLGZEJO-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|