C13H14N4O2 — CID 91091221
2-(2,4-dimethylphenyl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 91091221) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 91091221 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | Cc1ccc(-c2nc(C(N)=O)c(C(N)=O)[nH]2)c(C)c1 |
| InChI | InChI=1S/C13H14N4O2/c1-6-3-4-8(7(2)5-6)13-16-9(11(14)18)10(17-13)12(15)19/h3-5H,1-2H3,(H2,14,18)(H2,15,19)(H,16,17) |
| InChIKey | QHHVSXLALIGNAF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |