C28H18Cl2N8S — CID 91094609
1,2-bis(4-chlorophenyl)-1-(6-pyridin-2-ylpyrazin-2-yl)-2-[6-(1,3-thiazol-2-yl)pyrazin-2-yl]hydrazine (PubChem CID 91094609) has the molecular formula C28H18Cl2N8S and a molecular weight of 569.48 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)-1-(6-pyridin-2-ylpyrazin-2-yl)-2-[6-(1,3-thiazol-2-yl)pyrazin-2-yl]hydrazine.
| Compound Name | 1,2-bis(4-chlorophenyl)-1-(6-pyridin-2-ylpyrazin-2-yl)-2-[6-(1,3-thiazol-2-yl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 91094609 |
| Molecular Formula | C28H18Cl2N8S |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)-1-(6-pyridin-2-ylpyrazin-2-yl)-2-[6-(1,3-thiazol-2-yl)pyrazin-2-yl]hydrazine |
| SMILES | Clc1ccc(N(c2cncc(-c3ccccn3)n2)N(c2ccc(Cl)cc2)c2cncc(-c3nccs3)n2)cc1 |
| InChI | InChI=1S/C28H18Cl2N8S/c29-19-4-8-21(9-5-19)37(26-17-31-15-24(35-26)23-3-1-2-12-33-23)38(22-10-6-20(30)7-11-22)27-18-32-16-25(36-27)28-34-13-14-39-28/h1-18H |
| InChIKey | KQMJPKXIZIZRDP-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|