C28H22ClN11S2 — CID 90926681
1-(6-chloro-3-pyridinyl)-2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2-bis[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]hydrazine (PubChem CID 90926681) has the molecular formula C28H22ClN11S2 and a molecular weight of 612.15 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2-bis[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]hydrazine.
| Compound Name | 1-(6-chloro-3-pyridinyl)-2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2-bis[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 90926681 |
| Molecular Formula | C28H22ClN11S2 |
| Molecular Weight | 612.15 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2-bis[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]hydrazine |
| SMILES | Clc1ccc(N(c2nccc(-c3nccs3)n2)N(c2ccc(N3CCCC3)nc2)c2nccc(-c3nccs3)n2)cn1 |
| InChI | InChI=1S/C28H22ClN11S2/c29-23-5-3-19(17-34-23)39(27-32-9-7-21(36-27)25-30-11-15-41-25)40(20-4-6-24(35-18-20)38-13-1-2-14-38)28-33-10-8-22(37-28)26-31-12-16-42-26/h3-12,15-18H,1-2,13-14H2 |
| InChIKey | ZBRWHJDFHMGXAH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 112.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.15 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|