C34H24Cl2N10S3 — CID 90900649
1,2-bis[7-(2-chloro-4-pyridinyl)-2-methyl-[1,3]thiazolo[4,5-c]pyridin-4-yl]-1-(2-methyl-4-pyridinyl)-2-(2-methyl-1,3-thiazol-4-yl)hydrazine (PubChem CID 90900649) has the molecular formula C34H24Cl2N10S3 and a molecular weight of 739.74 g/mol. Its IUPAC name is 1,2-bis[7-(2-chloro-4-pyridinyl)-2-methyl-[1,3]thiazolo[4,5-c]pyridin-4-yl]-1-(2-methyl-4-pyridinyl)-2-(2-methyl-1,3-thiazol-4-yl)hydrazine.
| Compound Name | 1,2-bis[7-(2-chloro-4-pyridinyl)-2-methyl-[1,3]thiazolo[4,5-c]pyridin-4-yl]-1-(2-methyl-4-pyridinyl)-2-(2-methyl-1,3-thiazol-4-yl)hydrazine |
|---|---|
| PubChem CID | 90900649 |
| Molecular Formula | C34H24Cl2N10S3 |
| Molecular Weight | 739.74 g/mol |
| Exact Mass | 738.07 |
| IUPAC Name | 1,2-bis[7-(2-chloro-4-pyridinyl)-2-methyl-[1,3]thiazolo[4,5-c]pyridin-4-yl]-1-(2-methyl-4-pyridinyl)-2-(2-methyl-1,3-thiazol-4-yl)hydrazine |
| SMILES | Cc1cc(N(c2ncc(-c3ccnc(Cl)c3)c3sc(C)nc23)N(c2csc(C)n2)c2ncc(-c3ccnc(Cl)c3)c3sc(C)nc23)ccn1 |
| InChI | InChI=1S/C34H24Cl2N10S3/c1-17-11-23(7-10-37-17)45(33-29-31(48-19(3)43-29)24(14-40-33)21-5-8-38-26(35)12-21)46(28-16-47-18(2)42-28)34-30-32(49-20(4)44-30)25(15-41-34)22-6-9-39-27(36)13-22/h5-16H,1-4H3 |
| InChIKey | WCXPXBKSMWIJID-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.74 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|