C18H14ClN5S — CID 16661050
7-(2-chloro-4-pyridinyl)-2-methyl-N-(2-methyl-4-pyridinyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine (PubChem CID 16661050) has the molecular formula C18H14ClN5S and a molecular weight of 367.87 g/mol. Its IUPAC name is 7-(2-chloro-4-pyridinyl)-2-methyl-N-(2-methyl-4-pyridinyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine.
| Compound Name | 7-(2-chloro-4-pyridinyl)-2-methyl-N-(2-methyl-4-pyridinyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 16661050 |
| Molecular Formula | C18H14ClN5S |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 7-(2-chloro-4-pyridinyl)-2-methyl-N-(2-methyl-4-pyridinyl)-[1,3]thiazolo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cc(Nc2ncc(-c3ccnc(Cl)c3)c3sc(C)nc23)ccn1 |
| InChI | InChI=1S/C18H14ClN5S/c1-10-7-13(4-6-20-10)24-18-16-17(25-11(2)23-16)14(9-22-18)12-3-5-21-15(19)8-12/h3-9H,1-2H3,(H,20,22,24) |
| InChIKey | DGJIXERNUPKULF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|