C15H17ClO4 — CID 91094655
3-(4-chloro-2-ethyl-6-methoxyphenyl)-5,5-dimethyloxolane-2,4-dione (PubChem CID 91094655) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-(4-chloro-2-ethyl-6-methoxyphenyl)-5,5-dimethyloxolane-2,4-dione.
| Compound Name | 3-(4-chloro-2-ethyl-6-methoxyphenyl)-5,5-dimethyloxolane-2,4-dione |
|---|---|
| PubChem CID | 91094655 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(4-chloro-2-ethyl-6-methoxyphenyl)-5,5-dimethyloxolane-2,4-dione |
| SMILES | CCc1cc(Cl)cc(OC)c1C1C(=O)OC(C)(C)C1=O |
| InChI | InChI=1S/C15H17ClO4/c1-5-8-6-9(16)7-10(19-4)11(8)12-13(17)15(2,3)20-14(12)18/h6-7,12H,5H2,1-4H3 |
| InChIKey | FEWYWSGLWQZEEM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|