C19H20FNO — CID 91095889
(1R)-1-benzyl-4-fluorospiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 91095889) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is (1R)-1-benzyl-4-fluorospiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | (1R)-1-benzyl-4-fluorospiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 91095889 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (1R)-1-benzyl-4-fluorospiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | Fc1cccc2c1C1(CCNCC1)O[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C19H20FNO/c20-16-8-4-7-15-17(13-14-5-2-1-3-6-14)22-19(18(15)16)9-11-21-12-10-19/h1-8,17,21H,9-13H2/t17-/m1/s1 |
| InChIKey | LJOLKDHAFFQVMY-QGZVFWFLSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |