C28H41N5O8S2 — CID 91096600
N-[(2S)-1-[[6-amino-1-[(4-methoxyphenyl)sulfamoyl]hexan-2-yl]amino]-3-benzylsulfonyl-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 91096600) has the molecular formula C28H41N5O8S2 and a molecular weight of 639.80 g/mol. Its IUPAC name is N-[(2S)-1-[[6-amino-1-[(4-methoxyphenyl)sulfamoyl]hexan-2-yl]amino]-3-benzylsulfonyl-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[[6-amino-1-[(4-methoxyphenyl)sulfamoyl]hexan-2-yl]amino]-3-benzylsulfonyl-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 91096600 |
| Molecular Formula | C28H41N5O8S2 |
| Molecular Weight | 639.80 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | N-[(2S)-1-[[6-amino-1-[(4-methoxyphenyl)sulfamoyl]hexan-2-yl]amino]-3-benzylsulfonyl-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)CC(CCCCN)NC(=O)[C@@H](CS(=O)(=O)Cc2ccccc2)NC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H41N5O8S2/c1-40-25-12-10-23(11-13-25)32-43(38,39)20-24(9-5-6-14-29)30-27(34)26(31-28(35)33-15-17-41-18-16-33)21-42(36,37)19-22-7-3-2-4-8-22/h2-4,7-8,10-13,24,26,32H,5-6,9,14-21,29H2,1H3,(H,30,34)(H,31,35)/t24?,26-/m1/s1 |
| InChIKey | HJTHDOZBXZPTFK-JUERFOTFSA-N |
| XLogP | 1.08 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.80 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|