C10H21N3O2 — CID 91097434
(2R)-2-amino-3-methyl-N'-pentanoylbutanehydrazide (PubChem CID 91097434) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-N'-pentanoylbutanehydrazide.
| Compound Name | (2R)-2-amino-3-methyl-N'-pentanoylbutanehydrazide |
|---|---|
| PubChem CID | 91097434 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (2R)-2-amino-3-methyl-N'-pentanoylbutanehydrazide |
| SMILES | CCCCC(=O)NNC(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C10H21N3O2/c1-4-5-6-8(14)12-13-10(15)9(11)7(2)3/h7,9H,4-6,11H2,1-3H3,(H,12,14)(H,13,15)/t9-/m1/s1 |
| InChIKey | KZSDFVPBOLSXKC-SECBINFHSA-N |
| XLogP | 0.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|