C22H34N2 — CID 91097678
2-[(1S,4aR,4bS,7S,8aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanedinitrile (PubChem CID 91097678) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-[(1S,4aR,4bS,7S,8aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanedinitrile.
| Compound Name | 2-[(1S,4aR,4bS,7S,8aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanedinitrile |
|---|---|
| PubChem CID | 91097678 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 2-[(1S,4aR,4bS,7S,8aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanedinitrile |
| SMILES | CC(C)[C@H]1CC[C@H]2[C@H](CC[C@@H]3[C@]2(C)CCC[C@]3(C)C(C#N)C#N)C1 |
| InChI | InChI=1S/C22H34N2/c1-15(2)16-6-8-19-17(12-16)7-9-20-21(3,18(13-23)14-24)10-5-11-22(19,20)4/h15-20H,5-12H2,1-4H3/t16-,17+,19-,20-,21+,22+/m0/s1 |
| InChIKey | LFPASEDYSFNXHN-PTSWQDPMSA-N |
| XLogP | 5.94 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |