C22H12N6O5S — CID 91098572
7,8-diazido-5,6-dioxo-2,3-diphenylnaphthalene-1-sulfonic acid (PubChem CID 91098572) has the molecular formula C22H12N6O5S and a molecular weight of 472.44 g/mol. Its IUPAC name is 7,8-diazido-5,6-dioxo-2,3-diphenylnaphthalene-1-sulfonic acid.
| Compound Name | 7,8-diazido-5,6-dioxo-2,3-diphenylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 91098572 |
| Molecular Formula | C22H12N6O5S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 7,8-diazido-5,6-dioxo-2,3-diphenylnaphthalene-1-sulfonic acid |
| SMILES | [N-]=[N+]=NC1=C(N=[N+]=[N-])c2c(cc(-c3ccccc3)c(-c3ccccc3)c2S(=O)(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C22H12N6O5S/c23-27-25-18-17-15(20(29)21(30)19(18)26-28-24)11-14(12-7-3-1-4-8-12)16(22(17)34(31,32)33)13-9-5-2-6-10-13/h1-11H,(H,31,32,33) |
| InChIKey | YKJHEMVUOMILMR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 186.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|