C17H8N6O8S — CID 54003630
3-(7,8-diazido-5,6-dioxonaphthalen-1-yl)sulfonyloxy-5-hydroxybenzoic acid (PubChem CID 54003630) has the molecular formula C17H8N6O8S and a molecular weight of 456.35 g/mol. Its IUPAC name is 3-(7,8-diazido-5,6-dioxonaphthalen-1-yl)sulfonyloxy-5-hydroxybenzoic acid.
| Compound Name | 3-(7,8-diazido-5,6-dioxonaphthalen-1-yl)sulfonyloxy-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54003630 |
| Molecular Formula | C17H8N6O8S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 3-(7,8-diazido-5,6-dioxonaphthalen-1-yl)sulfonyloxy-5-hydroxybenzoic acid |
| SMILES | [N-]=[N+]=NC1=C(N=[N+]=[N-])c2c(cccc2S(=O)(=O)Oc2cc(O)cc(C(=O)O)c2)C(=O)C1=O |
| InChI | InChI=1S/C17H8N6O8S/c18-22-20-13-12-10(15(25)16(26)14(13)21-23-19)2-1-3-11(12)32(29,30)31-9-5-7(17(27)28)4-8(24)6-9/h1-6,24H,(H,27,28) |
| InChIKey | KNIKWLWTMHCTTG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 232.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|