C23H12N6O9S — CID 91162857
[3-(2,3,4-trihydroxybenzoyl)phenyl] 7,8-diazido-5,6-dioxonaphthalene-1-sulfonate (PubChem CID 91162857) has the molecular formula C23H12N6O9S and a molecular weight of 548.45 g/mol. Its IUPAC name is [3-(2,3,4-trihydroxybenzoyl)phenyl] 7,8-diazido-5,6-dioxonaphthalene-1-sulfonate.
| Compound Name | [3-(2,3,4-trihydroxybenzoyl)phenyl] 7,8-diazido-5,6-dioxonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 91162857 |
| Molecular Formula | C23H12N6O9S |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | [3-(2,3,4-trihydroxybenzoyl)phenyl] 7,8-diazido-5,6-dioxonaphthalene-1-sulfonate |
| SMILES | [N-]=[N+]=NC1=C(N=[N+]=[N-])c2c(cccc2S(=O)(=O)Oc2cccc(C(=O)c3ccc(O)c(O)c3O)c2)C(=O)C1=O |
| InChI | InChI=1S/C23H12N6O9S/c24-28-26-17-16-12(20(32)23(35)18(17)27-29-25)5-2-6-15(16)39(36,37)38-11-4-1-3-10(9-11)19(31)13-7-8-14(30)22(34)21(13)33/h1-9,30,33-34H |
| InChIKey | WDKIRCWRWHTFSC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 252.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|