C23H16N2O8S — CID 165340088
(6E)-6-diazo-5-oxonaphthalene-1-sulfonic acid;phenyl-(2,3,4-trihydroxyphenyl)methanone (PubChem CID 165340088) has the molecular formula C23H16N2O8S and a molecular weight of 480.45 g/mol. Its IUPAC name is (6E)-6-diazo-5-oxonaphthalene-1-sulfonic acid;phenyl-(2,3,4-trihydroxyphenyl)methanone.
| Compound Name | (6E)-6-diazo-5-oxonaphthalene-1-sulfonic acid;phenyl-(2,3,4-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 165340088 |
| Molecular Formula | C23H16N2O8S |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | (6E)-6-diazo-5-oxonaphthalene-1-sulfonic acid;phenyl-(2,3,4-trihydroxyphenyl)methanone |
| SMILES | O=C(c1ccccc1)c1ccc(O)c(O)c1O.[N-]=[N+]=C1C=Cc2c(cccc2S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H10O4.C10H6N2O4S/c14-10-7-6-9(12(16)13(10)17)11(15)8-4-2-1-3-5-8;11-12-8-5-4-6-7(10(8)13)2-1-3-9(6)17(14,15)16/h1-7,14,16-17H;1-5H,(H,14,15,16) |
| InChIKey | USSYSRZPXRRPHJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 185.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|