C19H14O7 — CID 158711705
cyclohexa-3,5-diene-1,2-dione;(4-hydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone (PubChem CID 158711705) has the molecular formula C19H14O7 and a molecular weight of 354.31 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dione;(4-hydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone.
| Compound Name | cyclohexa-3,5-diene-1,2-dione;(4-hydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 158711705 |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dione;(4-hydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)c1ccc(O)c(O)c1O.O=C1C=CC=CC1=O |
| InChI | InChI=1S/C13H10O5.C6H4O2/c14-8-3-1-7(2-4-8)11(16)9-5-6-10(15)13(18)12(9)17;7-5-3-1-2-4-6(5)8/h1-6,14-15,17-18H;1-4H |
| InChIKey | IIUQFLFUKNNNMS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|