C24H17NO5 — CID 135491450
[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-8-hydroxyquinolin-7-yl]-(4-hydroxyphenyl)methanone (PubChem CID 135491450) has the molecular formula C24H17NO5 and a molecular weight of 399.40 g/mol. Its IUPAC name is [2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-8-hydroxyquinolin-7-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-8-hydroxyquinolin-7-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 135491450 |
| Molecular Formula | C24H17NO5 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-8-hydroxyquinolin-7-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)c1ccc2ccc(/C=C/c3ccc(O)c(O)c3)nc2c1O |
| InChI | InChI=1S/C24H17NO5/c26-18-9-4-16(5-10-18)23(29)19-11-6-15-3-8-17(25-22(15)24(19)30)7-1-14-2-12-20(27)21(28)13-14/h1-13,26-28,30H/b7-1+ |
| InChIKey | GWFFRTBTZLGGEX-LREOWRDNSA-N |
| XLogP | 4.46 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|