C19H15NO5 — CID 135859880
1-[8-hydroxy-2-[(E)-2-(2,4,5-trihydroxyphenyl)ethenyl]quinolin-7-yl]ethanone (PubChem CID 135859880) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-[8-hydroxy-2-[(E)-2-(2,4,5-trihydroxyphenyl)ethenyl]quinolin-7-yl]ethanone.
| Compound Name | 1-[8-hydroxy-2-[(E)-2-(2,4,5-trihydroxyphenyl)ethenyl]quinolin-7-yl]ethanone |
|---|---|
| PubChem CID | 135859880 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[8-hydroxy-2-[(E)-2-(2,4,5-trihydroxyphenyl)ethenyl]quinolin-7-yl]ethanone |
| SMILES | CC(=O)c1ccc2ccc(/C=C/c3cc(O)c(O)cc3O)nc2c1O |
| InChI | InChI=1S/C19H15NO5/c1-10(21)14-7-4-11-2-5-13(20-18(11)19(14)25)6-3-12-8-16(23)17(24)9-15(12)22/h2-9,22-25H,1H3/b6-3+ |
| InChIKey | NHFCMSNFRLLTSO-ZZXKWVIFSA-N |
| XLogP | 3.43 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|