C31H26N2O11S — CID 170852716
6-diazo-5-oxonaphthalene-1-sulfonic acid;4-[[2-hydroxy-5-methyl-3-[(2,3,4-trihydroxyphenyl)methyl]phenyl]methyl]benzene-1,2,3-triol (PubChem CID 170852716) has the molecular formula C31H26N2O11S and a molecular weight of 634.62 g/mol. Its IUPAC name is 6-diazo-5-oxonaphthalene-1-sulfonic acid;4-[[2-hydroxy-5-methyl-3-[(2,3,4-trihydroxyphenyl)methyl]phenyl]methyl]benzene-1,2,3-triol.
| Compound Name | 6-diazo-5-oxonaphthalene-1-sulfonic acid;4-[[2-hydroxy-5-methyl-3-[(2,3,4-trihydroxyphenyl)methyl]phenyl]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 170852716 |
| Molecular Formula | C31H26N2O11S |
| Molecular Weight | 634.62 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | 6-diazo-5-oxonaphthalene-1-sulfonic acid;4-[[2-hydroxy-5-methyl-3-[(2,3,4-trihydroxyphenyl)methyl]phenyl]methyl]benzene-1,2,3-triol |
| SMILES | Cc1cc(Cc2ccc(O)c(O)c2O)c(O)c(Cc2ccc(O)c(O)c2O)c1.[N-]=[N+]=C1C=Cc2c(cccc2S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C21H20O7.C10H6N2O4S/c1-10-6-13(8-11-2-4-15(22)20(27)18(11)25)17(24)14(7-10)9-12-3-5-16(23)21(28)19(12)26;11-12-8-5-4-6-7(10(8)13)2-1-3-9(6)17(14,15)16/h2-7,22-28H,8-9H2,1H3;1-5H,(H,14,15,16) |
| InChIKey | BZGUJNJQQAWLEB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 249.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|