C23H12N6O10S — CID 91445605
[3-hydroxy-2-(2,3,4-trihydroxybenzoyl)phenyl] 2,8-diazido-3,4-dioxonaphthalene-1-sulfonate (PubChem CID 91445605) has the molecular formula C23H12N6O10S and a molecular weight of 564.45 g/mol. Its IUPAC name is [3-hydroxy-2-(2,3,4-trihydroxybenzoyl)phenyl] 2,8-diazido-3,4-dioxonaphthalene-1-sulfonate.
| Compound Name | [3-hydroxy-2-(2,3,4-trihydroxybenzoyl)phenyl] 2,8-diazido-3,4-dioxonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 91445605 |
| Molecular Formula | C23H12N6O10S |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | [3-hydroxy-2-(2,3,4-trihydroxybenzoyl)phenyl] 2,8-diazido-3,4-dioxonaphthalene-1-sulfonate |
| SMILES | [N-]=[N+]=NC1=C(S(=O)(=O)Oc2cccc(O)c2C(=O)c2ccc(O)c(O)c2O)c2c(N=[N+]=[N-])cccc2C(=O)C1=O |
| InChI | InChI=1S/C23H12N6O10S/c24-28-26-11-4-1-3-9-15(11)23(17(27-29-25)22(36)19(9)33)40(37,38)39-14-6-2-5-12(30)16(14)18(32)10-7-8-13(31)21(35)20(10)34/h1-8,30-31,34-35H |
| InChIKey | LFYJAVPVRVXOLP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 273.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|