About 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol
3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol (PubChem CID 91098679) has the molecular formula C16H30O7
and a molecular weight of 334.41 g/mol. Its IUPAC name is 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol.
Molecular Properties
| Compound Name | 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol |
| PubChem CID | 91098679 |
| Molecular Formula | C16H30O7 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol |
| SMILES | CCC1(C)CC(OC2C(O)OC(CO)C(C)C2O)OC(C)C1O |
| InChI | InChI=1S/C16H30O7/c1-5-16(4)6-11(21-9(3)14(16)19)23-13-12(18)8(2)10(7-17)22-15(13)20/h8-15,17-20H,5-7H2,1-4H3 |
| InChIKey | BNAFHIKCUOVMEI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol?
The IUPAC name of 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol (CID 91098679) is 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol.
What is the SMILES notation for 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol?
The canonical SMILES for 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol is CCC1(C)CC(OC2C(O)OC(CO)C(C)C2O)OC(C)C1O.
What is the InChIKey of 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol?
The InChIKey is BNAFHIKCUOVMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O7/c1-5-16(4)6-11(21-9(3)14(16)19)23-13-12(18)8(2)10(7-17)22-15(13)20/h8-15,17-20H,5-7H2,1-4H3.
What are the key properties of 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol?
3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol has a molecular weight of 334.41 g/mol, XLogP of -0.01, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethyl-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-6-(hydroxymethyl)-5-methyloxane-2,4-diol is sourced from PubChem (CID 91098679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).