C23H29NO5S — CID 91099722
tert-butyl 3-[bis(4-methoxyphenyl)methyl]-4-methyloxathiazolidine-4-carboxylate (PubChem CID 91099722) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is tert-butyl 3-[bis(4-methoxyphenyl)methyl]-4-methyloxathiazolidine-4-carboxylate.
| Compound Name | tert-butyl 3-[bis(4-methoxyphenyl)methyl]-4-methyloxathiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 91099722 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | tert-butyl 3-[bis(4-methoxyphenyl)methyl]-4-methyloxathiazolidine-4-carboxylate |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2SOCC2(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29NO5S/c1-22(2,3)29-21(25)23(4)15-28-30-24(23)20(16-7-11-18(26-5)12-8-16)17-9-13-19(27-6)14-10-17/h7-14,20H,15H2,1-6H3 |
| InChIKey | WIHVQEBORZNMFJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|