C11H16N4OS — CID 91100469
3-(dimethylaminodiazenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 91100469) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-(dimethylaminodiazenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-(dimethylaminodiazenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91100469 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-(dimethylaminodiazenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)/N=N/c1c(C(N)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C11H16N4OS/c1-15(2)14-13-9-7-5-3-4-6-8(7)17-10(9)11(12)16/h3-6H2,1-2H3,(H2,12,16)/b14-13+ |
| InChIKey | OMUOYQNDFAFGPL-BUHFOSPRSA-N |
| XLogP | 2.29 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|