C21H37N — CID 91102081
7-(3,4-dimethylphenyl)-N,N,3,6,6-pentamethyloctan-4-amine (PubChem CID 91102081) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is 7-(3,4-dimethylphenyl)-N,N,3,6,6-pentamethyloctan-4-amine.
| Compound Name | 7-(3,4-dimethylphenyl)-N,N,3,6,6-pentamethyloctan-4-amine |
|---|---|
| PubChem CID | 91102081 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | 7-(3,4-dimethylphenyl)-N,N,3,6,6-pentamethyloctan-4-amine |
| SMILES | CCC(C)C(CC(C)(C)C(C)c1ccc(C)c(C)c1)N(C)C |
| InChI | InChI=1S/C21H37N/c1-10-15(2)20(22(8)9)14-21(6,7)18(5)19-12-11-16(3)17(4)13-19/h11-13,15,18,20H,10,14H2,1-9H3 |
| InChIKey | NYOVHAQCZORPPA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |