C28H42N4O6 — CID 91102642
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dioxocyclohexyl)-N-[3-(3,4-dioxocyclohexyl)prop-2-enoyl]prop-2-enamide (PubChem CID 91102642) has the molecular formula C28H42N4O6 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dioxocyclohexyl)-N-[3-(3,4-dioxocyclohexyl)prop-2-enoyl]prop-2-enamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dioxocyclohexyl)-N-[3-(3,4-dioxocyclohexyl)prop-2-enoyl]prop-2-enamide |
|---|---|
| PubChem CID | 91102642 |
| Molecular Formula | C28H42N4O6 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dioxocyclohexyl)-N-[3-(3,4-dioxocyclohexyl)prop-2-enoyl]prop-2-enamide |
| SMILES | NCCCNCCCCNCCCN(C(=O)C=CC1CCC(=O)C(=O)C1)C(=O)C=CC1CCC(=O)C(=O)C1 |
| InChI | InChI=1S/C28H42N4O6/c29-13-3-16-30-14-1-2-15-31-17-4-18-32(27(37)11-7-21-5-9-23(33)25(35)19-21)28(38)12-8-22-6-10-24(34)26(36)20-22/h7-8,11-12,21-22,30-31H,1-6,9-10,13-20,29H2 |
| InChIKey | FAAAZSVKGJKHIQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|